CAS 41564-68-5 is the registry number for 3-(4-Chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(E)-3-(4-chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one (CAS 41564-68-5) is a chemical compound with the molecular formula C16H13ClO2 and a molecular weight of 272.72 g/mol. IUPAC name: (E)-3-(4-chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one. InChIKey: RESSHTKZHPRDTR-NYYWCZLTSA-N.
| Molecular formula | C16H13ClO2 |
|---|---|
| Molecular weight | 272.72 g/mol |
| IUPAC name | (E)-3-(4-chlorophenyl)-1-(4-methoxyphenyl)prop-2-en-1-one |
| InChIKey | RESSHTKZHPRDTR-NYYWCZLTSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)/C=C/C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)