CAS 488742-51-4 is the registry number for 6-Chloro-2-(methylsulfanyl)-(1,3)thiazolo(4,5-b)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine (CAS 488742-51-4) is a chemical compound with the molecular formula C7H5ClN2S2 and a molecular weight of 216.7 g/mol. IUPAC name: 6-chloro-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine. InChIKey: JJAFBJJBTOYNTC-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2S2 |
|---|---|
| Molecular weight | 216.7 g/mol |
| IUPAC name | 6-chloro-2-methylsulfanyl-[1,3]thiazolo[4,5-b]pyridine |
| InChIKey | JJAFBJJBTOYNTC-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(S1)C=C(C=N2)Cl |
Computed by PubChem (NCBI)