CAS 1338247-36-1 appears in our catalog under these names: 3-(Trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid, 97%, 3-(Trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid (CAS 1338247-36-1) is a chemical compound with the molecular formula C9H9F3N2O2 and a molecular weight of 234.17 g/mol. IUPAC name: 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid. InChIKey: FQWHXFWCSTWEHH-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O2 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazole-5-carboxylic acid |
| InChIKey | FQWHXFWCSTWEHH-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1C(=O)O)C(=NN2)C(F)(F)F |
Computed by PubChem (NCBI)