Products 1338543-45-5
CAS 1338543-45-5 is the registry number for 8-Methoxy-6-methylthieno[2,3-c]quinolin-4(5H)-one, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
8-methoxy-6-methyl-5H-thieno[2,3-c]quinolin-4-one (CAS 1338543-45-5) is a chemical compound with the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. IUPAC name: 8-methoxy-6-methyl-5H-thieno[2,3-c]quinolin-4-one. InChIKey: PCPPZVCAQSJRKO-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2S |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 8-methoxy-6-methyl-5H-thieno[2,3-c]quinolin-4-one |
| InChIKey | PCPPZVCAQSJRKO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=O)C3=C2C=CS3)OC |
Computed by PubChem (NCBI)