CAS 133860-75-0 appears in our catalog under these names: Chloroquine Impurity 1, 2-Chloro-N-(2-methylpropyl)-3-nitroquinolin-4-amine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 250mg.
2-chloro-N-(2-methylpropyl)-3-nitroquinolin-4-amine (CAS 133860-75-0) is a chemical compound with the molecular formula C13H14ClN3O2 and a molecular weight of 279.72 g/mol. IUPAC name: 2-chloro-N-(2-methylpropyl)-3-nitroquinolin-4-amine. InChIKey: DVWFDUDOJMSGAP-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O2 |
|---|---|
| Molecular weight | 279.72 g/mol |
| IUPAC name | 2-chloro-N-(2-methylpropyl)-3-nitroquinolin-4-amine |
| InChIKey | DVWFDUDOJMSGAP-UHFFFAOYSA-N |
| SMILES | CC(C)CNC1=C(C(=NC2=CC=CC=C21)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)