Products 1338682-74-8
CAS 1338682-74-8 is the registry number for 6-(3-Methyl-1,2,4-oxadiazol-5-yl)-4,5-dihydropyridazin-3(2h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(3-methyl-1,2,4-oxadiazol-5-yl)-4,5-dihydro-1H-pyridazin-6-one (CAS 1338682-74-8) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 180.16 g/mol. IUPAC name: 3-(3-methyl-1,2,4-oxadiazol-5-yl)-4,5-dihydro-1H-pyridazin-6-one. InChIKey: XPGWWEPQLYHARX-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 3-(3-methyl-1,2,4-oxadiazol-5-yl)-4,5-dihydro-1H-pyridazin-6-one |
| InChIKey | XPGWWEPQLYHARX-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=NNC(=O)CC2 |
Computed by PubChem (NCBI)