CAS 15837-08-8 appears in our catalog under these names: 3,9-Dimethyl-1H-purine-2,6(3H,9H)-dione, 97%, 3,9-dimethyl-1H-purine-2,6(3H,9H)-dione. Offered by: Chemat Brand. Available pack sizes: on request.
3,9-dimethylpurine-2,6-dione (CAS 15837-08-8) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 180.16 g/mol. IUPAC name: 3,9-dimethylpurine-2,6-dione. InChIKey: HEOWZFHIJSYJIC-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 3,9-dimethylpurine-2,6-dione |
| InChIKey | HEOWZFHIJSYJIC-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1N(C(=O)NC2=O)C |
Computed by PubChem (NCBI)