CAS 2044704-63-2 appears in our catalog under these names: Topiroxostat Impurity 6, Topiroxostat Impurity 25. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-(hydrazinecarbonyl)pyridine-2-carboxamide (CAS 2044704-63-2) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 180.16 g/mol. IUPAC name: 4-(hydrazinecarbonyl)pyridine-2-carboxamide. InChIKey: WSGDADWZFJFSJY-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 4-(hydrazinecarbonyl)pyridine-2-carboxamide |
| InChIKey | WSGDADWZFJFSJY-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(=O)NN)C(=O)N |
Computed by PubChem (NCBI)