Products 58-55-9
CAS 58-55-9 appears in our catalog under these names: Theophylline, 98%, Theophylline (Dimenhydrinate EP Impurity A, Diprophylline EP Impurity B), Theophiline, Theophylline, >95% (HPLC), Theophylline. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Lipomed. Available pack sizes: 100g, 500g, 1kg, 5g, 25g, on request, 100mg, 1g.
Theophylline is a dimethylxanthine having the two methyl groups located at positions 1 and 3. It is structurally similar to caffeine and is found in green and black tea. It has a role as a bronchodilator agent, a vasodilator agent, a drug metabolite, an anti-asthmatic drug, an EC 3.1.4.* (phosphoric diester hydrolase) inhibitor, an immunomodulator, a muscle relaxant, an anti-inflammatory agent, an adenosine receptor antagonist, a fungal metabolite and a human blood serum metabolite.
Source: ChEBI
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 1,3-dimethyl-7H-purine-2,6-dione |
| InChIKey | ZFXYFBGIUFBOJW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC=N2 |
Computed by PubChem (NCBI)