CAS 2851433-12-8 is the registry number for 1,3-Dimethyl-3,5-dihydro-1H-imidazo[4,5-d]pyridazine-2,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-dimethyl-6H-imidazo[4,5-d]pyridazine-2,7-dione (CAS 2851433-12-8) is a chemical compound with the molecular formula C7H8N4O2 and a molecular weight of 180.16 g/mol. IUPAC name: 1,3-dimethyl-6H-imidazo[4,5-d]pyridazine-2,7-dione. InChIKey: QQMXTQUSJLDHIU-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O2 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 1,3-dimethyl-6H-imidazo[4,5-d]pyridazine-2,7-dione |
| InChIKey | QQMXTQUSJLDHIU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)NN=C2)N(C1=O)C |
Computed by PubChem (NCBI)