CAS 1339074-00-8 is the registry number for 2-(5-(2-(Methylamino)thiazol-4-yl)thiophen-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[5-[2-(methylamino)-1,3-thiazol-4-yl]thiophen-2-yl]acetic acid (CAS 1339074-00-8) is a chemical compound with the molecular formula C10H10N2O2S2 and a molecular weight of 254.3 g/mol. IUPAC name: 2-[5-[2-(methylamino)-1,3-thiazol-4-yl]thiophen-2-yl]acetic acid. InChIKey: QZQRAUOFZVBFQL-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S2 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | 2-[5-[2-(methylamino)-1,3-thiazol-4-yl]thiophen-2-yl]acetic acid |
| InChIKey | QZQRAUOFZVBFQL-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=CS1)C2=CC=C(S2)CC(=O)O |
Computed by PubChem (NCBI)