CAS 1394041-78-1 is the registry number for 2-Methyl-5-phenyl-1,3-thiazole-4-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methyl-5-phenyl-1,3-thiazole-4-sulfonamide (CAS 1394041-78-1) is a chemical compound with the molecular formula C10H10N2O2S2 and a molecular weight of 254.3 g/mol. IUPAC name: 2-methyl-5-phenyl-1,3-thiazole-4-sulfonamide. InChIKey: YBIMRQFAVATZRH-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S2 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | 2-methyl-5-phenyl-1,3-thiazole-4-sulfonamide |
| InChIKey | YBIMRQFAVATZRH-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)C2=CC=CC=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)