CAS 2085758-34-3 is the registry number for 3-(4-Methyl-1,3-thiazol-2-yl)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide (CAS 2085758-34-3) is a chemical compound with the molecular formula C10H10N2O2S2 and a molecular weight of 254.3 g/mol. IUPAC name: 3-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide. InChIKey: PIFBWWGVGCTQAS-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2S2 |
|---|---|
| Molecular weight | 254.3 g/mol |
| IUPAC name | 3-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
| InChIKey | PIFBWWGVGCTQAS-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)C2=CC(=CC=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)