CAS 1339544-40-9 is the registry number for tert-Butyl 2-fluoropyridine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl 2-fluoropyridine-4-carboxylate (CAS 1339544-40-9) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: tert-butyl 2-fluoropyridine-4-carboxylate. InChIKey: KQNXSWQMRTXJJB-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | tert-butyl 2-fluoropyridine-4-carboxylate |
| InChIKey | KQNXSWQMRTXJJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=NC=C1)F |
Computed by PubChem (NCBI)