Products 2228694-85-5
CAS 2228694-85-5 appears in our catalog under these names: 2–(4–bromo–3–methoxyphenyl)–2，2–difluoroacetic acid, 2-(4-Bromo-3-methoxyphenyl)-2,2-difluoroacetic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
2-(4-bromo-3-methoxyphenyl)-2,2-difluoroacetic acid (CAS 2228694-85-5) is a chemical compound with the molecular formula C9H7BrF2O3 and a molecular weight of 281.05 g/mol. IUPAC name: 2-(4-bromo-3-methoxyphenyl)-2,2-difluoroacetic acid. InChIKey: DMFYAOBJCLYGKK-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O3 |
|---|---|
| Molecular weight | 281.05 g/mol |
| IUPAC name | 2-(4-bromo-3-methoxyphenyl)-2,2-difluoroacetic acid |
| InChIKey | DMFYAOBJCLYGKK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(C(=O)O)(F)F)Br |
Computed by PubChem (NCBI)