CAS 1340072-26-5 is the registry number for 3-chloro-N-(1-cyanocyclobutyl)-2,2-dimethylpropanamide, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
3-chloro-N-(1-cyanocyclobutyl)-2,2-dimethylpropanamide (CAS 1340072-26-5) is a chemical compound with the molecular formula C10H15ClN2O and a molecular weight of 214.69 g/mol. IUPAC name: 3-chloro-N-(1-cyanocyclobutyl)-2,2-dimethylpropanamide. InChIKey: RIJJZCCAHSVGQX-UHFFFAOYSA-N.
| Molecular formula | C10H15ClN2O |
|---|---|
| Molecular weight | 214.69 g/mol |
| IUPAC name | 3-chloro-N-(1-cyanocyclobutyl)-2,2-dimethylpropanamide |
| InChIKey | RIJJZCCAHSVGQX-UHFFFAOYSA-N |
| SMILES | CC(C)(CCl)C(=O)NC1(CCC1)C#N |
Computed by PubChem (NCBI)