CAS 1340349-50-9 appears in our catalog under these names: 1-(4-Methoxyphenyl)-3-oxocyclobutanecarboxylic acid, 95%, 1–(4–Methoxyphenyl)–3–oxocyclobutanecarboxylic Acid, 1-(4-Methoxyphenyl)-3-oxocyclobutanecarboxylic Acid, 98%, 98%, 1-(4-Methoxyphenyl)-3-oxocyclobutane-1-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
1-(4-methoxyphenyl)-3-oxocyclobutane-1-carboxylic acid (CAS 1340349-50-9) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: 1-(4-methoxyphenyl)-3-oxocyclobutane-1-carboxylic acid. InChIKey: OPBBOSTZEIPADV-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-3-oxocyclobutane-1-carboxylic acid |
| InChIKey | OPBBOSTZEIPADV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2(CC(=O)C2)C(=O)O |
Computed by PubChem (NCBI)