CAS 1341063-89-5 appears in our catalog under these names: Ethyl 3-amino-2-chloro-4,5-difluorobenzoate, 95%, Ethyl 3-amino-2-chloro-4,5-difluorobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Ethyl 3-amino-2-chloro-4,5-difluorobenzoate (CAS 1341063-89-5) is a chemical compound with the molecular formula C9H8ClF2NO2 and a molecular weight of 235.61 g/mol. IUPAC name: ethyl 3-amino-2-chloro-4,5-difluorobenzoate. InChIKey: WRGHWRKYFABSHT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2NO2 |
|---|---|
| Molecular weight | 235.61 g/mol |
| IUPAC name | ethyl 3-amino-2-chloro-4,5-difluorobenzoate |
| InChIKey | WRGHWRKYFABSHT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1Cl)N)F)F |
Computed by PubChem (NCBI)