CAS 1706431-62-0 is the registry number for 4-Chloro-3,5-difluoro-dl-phenylalanine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-amino-3-(4-chloro-3,5-difluorophenyl)propanoic acid (CAS 1706431-62-0) is a chemical compound with the molecular formula C9H8ClF2NO2 and a molecular weight of 235.61 g/mol. IUPAC name: 2-amino-3-(4-chloro-3,5-difluorophenyl)propanoic acid. InChIKey: DAAWRQXSPDLJGK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2NO2 |
|---|---|
| Molecular weight | 235.61 g/mol |
| IUPAC name | 2-amino-3-(4-chloro-3,5-difluorophenyl)propanoic acid |
| InChIKey | DAAWRQXSPDLJGK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)F)CC(C(=O)O)N |
Computed by PubChem (NCBI)