Products 1397008-33-1
CAS 1397008-33-1 appears in our catalog under these names: Ethyl 2-(6-chloropyridin-3-yl)-2,2-difluoroacetate, Ethyl 2-(6-chloropyridin-3-yl)-2,2-difluoroacetate, 98%. Offered by: Biosynth, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
Ethyl 2-(6-chloro-3-pyridinyl)-2,2-difluoroacetate (CAS 1397008-33-1) is a chemical compound with the molecular formula C9H8ClF2NO2 and a molecular weight of 235.61 g/mol. IUPAC name: ethyl 2-(6-chloro-3-pyridinyl)-2,2-difluoroacetate. InChIKey: MOODARGYEGTZII-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2NO2 |
|---|---|
| Molecular weight | 235.61 g/mol |
| IUPAC name | ethyl 2-(6-chloro-3-pyridinyl)-2,2-difluoroacetate |
| InChIKey | MOODARGYEGTZII-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CN=C(C=C1)Cl)(F)F |
Computed by PubChem (NCBI)