Products 1706428-57-0
CAS 1706428-57-0 appears in our catalog under these names: 6-Chloro-2,3-difluoro-dl-phenylalanine, 95%, 2-Amino-3-(6-chloro-2,3-difluorophenyl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-amino-3-(6-chloro-2,3-difluorophenyl)propanoic acid (CAS 1706428-57-0) is a chemical compound with the molecular formula C9H8ClF2NO2 and a molecular weight of 235.61 g/mol. IUPAC name: 2-amino-3-(6-chloro-2,3-difluorophenyl)propanoic acid. InChIKey: IFZQIOJLTTYTIK-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2NO2 |
|---|---|
| Molecular weight | 235.61 g/mol |
| IUPAC name | 2-amino-3-(6-chloro-2,3-difluorophenyl)propanoic acid |
| InChIKey | IFZQIOJLTTYTIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)CC(C(=O)O)N)Cl |
Computed by PubChem (NCBI)