CAS 1804705-94-9 is the registry number for ETHYL 3-CHLORO-5-(DIFLUOROMETHYL)PICOLINATE, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate (CAS 1804705-94-9) is a chemical compound with the molecular formula C9H8ClF2NO2 and a molecular weight of 235.61 g/mol. IUPAC name: ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate. InChIKey: FCKUBRRFBRDHLV-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF2NO2 |
|---|---|
| Molecular weight | 235.61 g/mol |
| IUPAC name | ethyl 3-chloro-5-(difluoromethyl)pyridine-2-carboxylate |
| InChIKey | FCKUBRRFBRDHLV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=N1)C(F)F)Cl |
Computed by PubChem (NCBI)