CAS 1341322-71-1 appears in our catalog under these names: 2-(2,4-Dimethylphenyl)-2,2-difluoroacetic acid, 95%, 2–(2，4–dimethylphenyl)–2，2–difluoroacetic acid, 2-(2,4-Dimethylphenyl)-2,2-difluoroacetic acid, 98%, 98%, 2-(2,4-Dimethylphenyl)-2,2-difluoroacetic acid, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-(2,4-dimethylphenyl)-2,2-difluoroacetic acid (CAS 1341322-71-1) is a chemical compound with the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. IUPAC name: 2-(2,4-dimethylphenyl)-2,2-difluoroacetic acid. InChIKey: KVMUGLLIZFSHNE-UHFFFAOYSA-N.
| Molecular formula | C10H10F2O2 |
|---|---|
| Molecular weight | 200.18 g/mol |
| IUPAC name | 2-(2,4-dimethylphenyl)-2,2-difluoroacetic acid |
| InChIKey | KVMUGLLIZFSHNE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(C(=O)O)(F)F)C |
Computed by PubChem (NCBI)