Products 1341531-84-7
CAS 1341531-84-7 is the registry number for 3,3-Dimethylpiperidine-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3,3-dimethylpiperidine-1-sulfonyl chloride (CAS 1341531-84-7) is a chemical compound with the molecular formula C7H14ClNO2S and a molecular weight of 211.71 g/mol. IUPAC name: 3,3-dimethylpiperidine-1-sulfonyl chloride. InChIKey: BBRNSKZGTTVJLB-UHFFFAOYSA-N.
| Molecular formula | C7H14ClNO2S |
|---|---|
| Molecular weight | 211.71 g/mol |
| IUPAC name | 3,3-dimethylpiperidine-1-sulfonyl chloride |
| InChIKey | BBRNSKZGTTVJLB-UHFFFAOYSA-N |
| SMILES | CC1(CCCN(C1)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)