CAS 1341602-23-0 appears in our catalog under these names: 7-Bromo-2-methyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione, 95%, 7-Bromo-2-methyl-1,2,3,4-tetrahydroisoquinoline-1,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-bromo-2-methyl-4H-isoquinoline-1,3-dione (CAS 1341602-23-0) is a chemical compound with the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. IUPAC name: 7-bromo-2-methyl-4H-isoquinoline-1,3-dione. InChIKey: ADRFBHOQTPBMKI-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 7-bromo-2-methyl-4H-isoquinoline-1,3-dione |
| InChIKey | ADRFBHOQTPBMKI-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)