CAS 1341801-56-6 appears in our catalog under these names: 5-Bromo-2-(2,2,2-trifluoroethyl)-1H-1,3-benzodiazole, 95%, 5-Bromo-2-(2,2,2-trifluoroethyl)-1H-1,3-benzodiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-bromo-2-(2,2,2-trifluoroethyl)-1H-benzimidazole (CAS 1341801-56-6) is a chemical compound with the molecular formula C9H6BrF3N2 and a molecular weight of 279.06 g/mol. IUPAC name: 6-bromo-2-(2,2,2-trifluoroethyl)-1H-benzimidazole. InChIKey: PEXISVLMFCMBLF-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3N2 |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 6-bromo-2-(2,2,2-trifluoroethyl)-1H-benzimidazole |
| InChIKey | PEXISVLMFCMBLF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC(=N2)CC(F)(F)F |
Computed by PubChem (NCBI)