CAS 92367-11-8 appears in our catalog under these names: 4–(3–(Trifluoromethyl)–3H–diazirin–3–yl)benzyl Bromide, 4-[3-(Trifluoromethyl)-3H-diazirin-3-yl]benzyl Bromide, >95.0%(HPLC), 4-[3-(Trifluoromethyl)-3H-diazirin-3-yl]benzyl Bromide, 95%, 95%, 3-(4-(BROMOMETHYL)PHENYL)-3-(TRIFLUOROMETHYL)-3H-DIAZIRINE, 95%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 200mg, 250mg, 5g, 50mg, 100mg.
3-[4-(bromomethyl)phenyl]-3-(trifluoromethyl)diazirine (CAS 92367-11-8) is a chemical compound with the molecular formula C9H6BrF3N2 and a molecular weight of 279.06 g/mol. IUPAC name: 3-[4-(bromomethyl)phenyl]-3-(trifluoromethyl)diazirine. InChIKey: BCFUQXOZHPIAPS-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3N2 |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 3-[4-(bromomethyl)phenyl]-3-(trifluoromethyl)diazirine |
| InChIKey | BCFUQXOZHPIAPS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)C2(N=N2)C(F)(F)F |
Computed by PubChem (NCBI)