CAS 2606589-69-7 is the registry number for 5-Bromo-2-methyl-6-(trifluoromethyl)-1,3-benzodiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-bromo-2-methyl-6-(trifluoromethyl)-1H-benzimidazole (CAS 2606589-69-7) is a chemical compound with the molecular formula C9H6BrF3N2 and a molecular weight of 279.06 g/mol. IUPAC name: 5-bromo-2-methyl-6-(trifluoromethyl)-1H-benzimidazole. InChIKey: RZVRZXNIRUQICG-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3N2 |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 5-bromo-2-methyl-6-(trifluoromethyl)-1H-benzimidazole |
| InChIKey | RZVRZXNIRUQICG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C(=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)