Products 162845-02-5
CAS 162845-02-5 is the registry number for 3-(3-(Bromomethyl)phenyl)-3-(trifluoromethyl)-3H-diazirine, 94%. Offered by: Ambeed. Available pack sizes: 100mg.
3-[3-(bromomethyl)phenyl]-3-(trifluoromethyl)diazirine (CAS 162845-02-5) is a chemical compound with the molecular formula C9H6BrF3N2 and a molecular weight of 279.06 g/mol. IUPAC name: 3-[3-(bromomethyl)phenyl]-3-(trifluoromethyl)diazirine. InChIKey: CRJFPFARGFDZOA-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3N2 |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 3-[3-(bromomethyl)phenyl]-3-(trifluoromethyl)diazirine |
| InChIKey | CRJFPFARGFDZOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2(N=N2)C(F)(F)F)CBr |
Computed by PubChem (NCBI)