Products 1801697-86-8
CAS 1801697-86-8 appears in our catalog under these names: 7-Bromo-1-methyl-5-(trifluoromethyl)benzimidazole, 98%, 7-Bromo-1-methyl-5-(trifluoromethyl)benzimidazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g, 2g.
7-bromo-1-methyl-5-(trifluoromethyl)benzimidazole (CAS 1801697-86-8) is a chemical compound with the molecular formula C9H6BrF3N2 and a molecular weight of 279.06 g/mol. IUPAC name: 7-bromo-1-methyl-5-(trifluoromethyl)benzimidazole. InChIKey: TVFCEADQYIAZOM-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3N2 |
|---|---|
| Molecular weight | 279.06 g/mol |
| IUPAC name | 7-bromo-1-methyl-5-(trifluoromethyl)benzimidazole |
| InChIKey | TVFCEADQYIAZOM-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C(=CC(=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)