CAS 1341828-39-4 appears in our catalog under these names: (3-Methyl-1,2,4-oxadiazol-5-yl)(phenyl)methanol, 95%, (3-Methyl-1,2,4-oxadiazol-5-yl)(phenyl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
(3-methyl-1,2,4-oxadiazol-5-yl)-phenylmethanol (CAS 1341828-39-4) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: (3-methyl-1,2,4-oxadiazol-5-yl)-phenylmethanol. InChIKey: ASOQZCFXVZTJLT-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | (3-methyl-1,2,4-oxadiazol-5-yl)-phenylmethanol |
| InChIKey | ASOQZCFXVZTJLT-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)