Products 1341876-01-4
CAS 1341876-01-4 is the registry number for ethyl 2-(4-chloro-2,5-dimethylphenyl)-2-oxoacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(4-chloro-2,5-dimethylphenyl)-2-oxoacetate (CAS 1341876-01-4) is a chemical compound with the molecular formula C12H13ClO3 and a molecular weight of 240.68 g/mol. IUPAC name: ethyl 2-(4-chloro-2,5-dimethylphenyl)-2-oxoacetate. InChIKey: VNEHXZGPPXESNY-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO3 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | ethyl 2-(4-chloro-2,5-dimethylphenyl)-2-oxoacetate |
| InChIKey | VNEHXZGPPXESNY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=C(C=C(C(=C1)C)Cl)C |
Computed by PubChem (NCBI)