CAS 1342130-35-1 appears in our catalog under these names: 1-(2,2-Difluoroethyl)-1H-pyrazole-5-carboxylic acid, 1-(2,2-Difluoroethyl)-1H-pyrazole-5-carboxylic acid, 98%, 98%, 1-(2,2-Difluoroethyl)-1H-pyrazole-5-carboxylic acid, 97%, 1-(2,2-Difluoroethyl)-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
2-(2,2-difluoroethyl)pyrazole-3-carboxylic acid (CAS 1342130-35-1) is a chemical compound with the molecular formula C6H6F2N2O2 and a molecular weight of 176.12 g/mol. IUPAC name: 2-(2,2-difluoroethyl)pyrazole-3-carboxylic acid. InChIKey: KCLCELLKUDRQFF-UHFFFAOYSA-N.
| Molecular formula | C6H6F2N2O2 |
|---|---|
| Molecular weight | 176.12 g/mol |
| IUPAC name | 2-(2,2-difluoroethyl)pyrazole-3-carboxylic acid |
| InChIKey | KCLCELLKUDRQFF-UHFFFAOYSA-N |
| SMILES | C1=C(N(N=C1)CC(F)F)C(=O)O |
Computed by PubChem (NCBI)