Products 1342568-17-5

CAS 1342568-17-5 appears in our catalog under these names: 2,3-Dimethyl-5-sulfamoylbenzoic acid, 2,3-Dimethyl-5-sulfamoylbenzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.

Structural formula: {0} (CAS {1})

2,3-dimethyl-5-sulfamoylbenzoic acid (CAS 1342568-17-5) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 2,3-dimethyl-5-sulfamoylbenzoic acid. InChIKey: BGZNHSPYPVAMEF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO4S
Molecular weight229.26 g/mol
IUPAC name2,3-dimethyl-5-sulfamoylbenzoic acid
InChIKeyBGZNHSPYPVAMEF-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1C)C(=O)O)S(=O)(=O)N

Computed by PubChem (NCBI)