Products 1342846-40-5

CAS 1342846-40-5 is the registry number for 5-Acrylamidonicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(prop-2-enoylamino)pyridine-3-carboxylic acid (CAS 1342846-40-5) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 5-(prop-2-enoylamino)pyridine-3-carboxylic acid. InChIKey: FRBLXZIGYYNBFT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8N2O3
Molecular weight192.17 g/mol
IUPAC name5-(prop-2-enoylamino)pyridine-3-carboxylic acid
InChIKeyFRBLXZIGYYNBFT-UHFFFAOYSA-N
SMILESC=CC(=O)NC1=CN=CC(=C1)C(=O)O

Computed by PubChem (NCBI)