Products 1343038-98-1

CAS 1343038-98-1 is the registry number for 5-(5-Methylisoxazole-3-carboxamido)pentanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-[(5-methyl-1,2-oxazole-3-carbonyl)amino]pentanoic acid (CAS 1343038-98-1) is a chemical compound with the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. IUPAC name: 5-[(5-methyl-1,2-oxazole-3-carbonyl)amino]pentanoic acid. InChIKey: BZOOSZCTXRVXML-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N2O4
Molecular weight226.23 g/mol
IUPAC name5-[(5-methyl-1,2-oxazole-3-carbonyl)amino]pentanoic acid
InChIKeyBZOOSZCTXRVXML-UHFFFAOYSA-N
SMILESCC1=CC(=NO1)C(=O)NCCCCC(=O)O

Computed by PubChem (NCBI)