CAS 1343225-44-4 appears in our catalog under these names: 5-Cyano-N,N-dimethylpyridine-2-carboxamide, 95%, 5-Cyano-N,N-dimethylpyridine-2-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-cyano-N,N-dimethylpyridine-2-carboxamide (CAS 1343225-44-4) is a chemical compound with the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. IUPAC name: 5-cyano-N,N-dimethylpyridine-2-carboxamide. InChIKey: AKSXADYDAQVBMV-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O |
|---|---|
| Molecular weight | 175.19 g/mol |
| IUPAC name | 5-cyano-N,N-dimethylpyridine-2-carboxamide |
| InChIKey | AKSXADYDAQVBMV-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=NC=C(C=C1)C#N |
Computed by PubChem (NCBI)