CAS 1343241-61-1 appears in our catalog under these names: 2-Amino-2-(3-chlorophenyl)-3,3,3-trifluoropropanoic acid, 95%, 2-Amino-2-(3-chlorophenyl)-3,3,3-trifluoropropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-2-(3-chlorophenyl)-3,3,3-trifluoropropanoic acid (CAS 1343241-61-1) is a chemical compound with the molecular formula C9H7ClF3NO2 and a molecular weight of 253.60 g/mol. IUPAC name: 2-amino-2-(3-chlorophenyl)-3,3,3-trifluoropropanoic acid. InChIKey: NFMBOQZZSHPESJ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO2 |
|---|---|
| Molecular weight | 253.60 g/mol |
| IUPAC name | 2-amino-2-(3-chlorophenyl)-3,3,3-trifluoropropanoic acid |
| InChIKey | NFMBOQZZSHPESJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(C(=O)O)(C(F)(F)F)N |
Computed by PubChem (NCBI)