CAS 1343260-98-9 is the registry number for 4-Chloro-2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-chloro-2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol (CAS 1343260-98-9) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 4-chloro-2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol. InChIKey: GYOANZAOUANFHU-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 4-chloro-2-(3-methyl-1,2,4-oxadiazol-5-yl)phenol |
| InChIKey | GYOANZAOUANFHU-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=N1)C2=C(C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)