Products 1343379-24-7

CAS 1343379-24-7 is the registry number for 2-(9H-Fluoren-9-ylmethoxycarbonylamino)-5-hydroxy-benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxybenzoic acid (CAS 1343379-24-7) is a chemical compound with the molecular formula C22H17NO5 and a molecular weight of 375.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxybenzoic acid. InChIKey: WMDSGFKGGTXFOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H17NO5
Molecular weight375.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxybenzoic acid
InChIKeyWMDSGFKGGTXFOZ-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=C(C=C4)O)C(=O)O

Computed by PubChem (NCBI)