CAS 176442-21-0 appears in our catalog under these names: 3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-5-hydroxybenzoic acid, 97+% , 3-((((9h-Fluoren-9-yl)methoxy)carbonyl)amino)-5-hydroxybenzoic acid, 98%. Offered by: Thermo Scientific, Fluorochem. Available pack sizes: 1g, 5g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxybenzoic acid (CAS 176442-21-0) is a chemical compound with the molecular formula C22H17NO5 and a molecular weight of 375.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxybenzoic acid. InChIKey: WGBZDECNYLZYRE-UHFFFAOYSA-N.
| Molecular formula | C22H17NO5 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxybenzoic acid |
| InChIKey | WGBZDECNYLZYRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC(=CC(=C4)C(=O)O)O |
Computed by PubChem (NCBI)