CAS 1694923-46-0 appears in our catalog under these names: 3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-hydroxybenzoic acid, 95%, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-hydroxybenzoic acid, 98%, 3-(9H-Fluoren-9-ylmethoxycarbonylamino)-4-hydroxy-benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 50mg, 0,5g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-hydroxybenzoic acid (CAS 1694923-46-0) is a chemical compound with the molecular formula C22H17NO5 and a molecular weight of 375.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-hydroxybenzoic acid. InChIKey: YHVBZSPABQQKNR-UHFFFAOYSA-N.
| Molecular formula | C22H17NO5 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-hydroxybenzoic acid |
| InChIKey | YHVBZSPABQQKNR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=CC(=C4)C(=O)O)O |
Computed by PubChem (NCBI)