Products 1344201-09-7

CAS 1344201-09-7 is the registry number for 4-{((9H-Fluoren-9-ylmethoxy)carbonyl)amino}-3-hydroxybenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybenzoic acid (CAS 1344201-09-7) is a chemical compound with the molecular formula C22H17NO5 and a molecular weight of 375.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybenzoic acid. InChIKey: FJHKPJUMDNWUJA-UHFFFAOYSA-N.

Identity
Molecular formulaC22H17NO5
Molecular weight375.4 g/mol
IUPAC name4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybenzoic acid
InChIKeyFJHKPJUMDNWUJA-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=C(C=C4)C(=O)O)O

Computed by PubChem (NCBI)