CAS 150256-43-2 is the registry number for 4-(((9H-fluoren-9-ylmethoxy)carbonyl)amino)-2-hydroxybenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxybenzoic acid (CAS 150256-43-2) is a chemical compound with the molecular formula C22H17NO5 and a molecular weight of 375.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxybenzoic acid. InChIKey: IQQJSFOWWOGISM-UHFFFAOYSA-N.
| Molecular formula | C22H17NO5 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-hydroxybenzoic acid |
| InChIKey | IQQJSFOWWOGISM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC(=C(C=C4)C(=O)O)O |
Computed by PubChem (NCBI)