CAS 1343597-11-4 appears in our catalog under these names: 1-(2-Chloro-4-(1H-1,2,4-triazol-1-yl)phenyl)ethan-1-ol, 95%, 1-(2-Chloro-4-(1H-1,2,4-triazol-1-yl)phenyl)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[2-chloro-4-(1,2,4-triazol-1-yl)phenyl]ethanol (CAS 1343597-11-4) is a chemical compound with the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. IUPAC name: 1-[2-chloro-4-(1,2,4-triazol-1-yl)phenyl]ethanol. InChIKey: WHZYVSKVEUOIND-UHFFFAOYSA-N.
| Molecular formula | C10H10ClN3O |
|---|---|
| Molecular weight | 223.66 g/mol |
| IUPAC name | 1-[2-chloro-4-(1,2,4-triazol-1-yl)phenyl]ethanol |
| InChIKey | WHZYVSKVEUOIND-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)N2C=NC=N2)Cl)O |
Computed by PubChem (NCBI)