CAS 1343693-98-0 appears in our catalog under these names: 1,2,3,4-Tetrahydronaphthalen-1-ylmethanesulfonyl chloride, 95%, 1,2,3,4-Tetrahydronaphthalen-1-ylmethanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,2,3,4-tetrahydronaphthalen-1-ylmethanesulfonyl chloride (CAS 1343693-98-0) is a chemical compound with the molecular formula C11H13ClO2S and a molecular weight of 244.74 g/mol. IUPAC name: 1,2,3,4-tetrahydronaphthalen-1-ylmethanesulfonyl chloride. InChIKey: PKBCSRHULHVDQN-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO2S |
|---|---|
| Molecular weight | 244.74 g/mol |
| IUPAC name | 1,2,3,4-tetrahydronaphthalen-1-ylmethanesulfonyl chloride |
| InChIKey | PKBCSRHULHVDQN-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)