CAS 5829-79-8 is the registry number for ((2E)-4-Chloro-2-methylbut-2-ene-1-sulfonyl)benzene. Offered by: TRC, Biosynth. Available pack sizes: 500mg.
[(E)-4-chloro-2-methylbut-2-enyl]sulfonylbenzene (CAS 5829-79-8) is a chemical compound with the molecular formula C11H13ClO2S and a molecular weight of 244.74 g/mol. IUPAC name: [(E)-4-chloro-2-methylbut-2-enyl]sulfonylbenzene. InChIKey: ZFPKVGLCPNFQJH-JXMROGBWSA-N.
| Molecular formula | C11H13ClO2S |
|---|---|
| Molecular weight | 244.74 g/mol |
| IUPAC name | [(E)-4-chloro-2-methylbut-2-enyl]sulfonylbenzene |
| InChIKey | ZFPKVGLCPNFQJH-JXMROGBWSA-N |
| SMILES | C/C(=C\CCl)/CS(=O)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)