CAS 1452183-85-5 is the registry number for 1,1-Dimethyl-2,3-dihydro-1H-indene-5-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1-dimethyl-2,3-dihydroindene-5-sulfonyl chloride (CAS 1452183-85-5) is a chemical compound with the molecular formula C11H13ClO2S and a molecular weight of 244.74 g/mol. IUPAC name: 1,1-dimethyl-2,3-dihydroindene-5-sulfonyl chloride. InChIKey: WEMFCBNBIJYXOP-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO2S |
|---|---|
| Molecular weight | 244.74 g/mol |
| IUPAC name | 1,1-dimethyl-2,3-dihydroindene-5-sulfonyl chloride |
| InChIKey | WEMFCBNBIJYXOP-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C1C=CC(=C2)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)