Products 1803586-52-8

CAS 1803586-52-8 is the registry number for 2-(2,3-Dihydro-1H-inden-2-yl)ethane-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-(2,3-dihydro-1H-inden-2-yl)ethanesulfonyl chloride (CAS 1803586-52-8) is a chemical compound with the molecular formula C11H13ClO2S and a molecular weight of 244.74 g/mol. IUPAC name: 2-(2,3-dihydro-1H-inden-2-yl)ethanesulfonyl chloride. InChIKey: QZUYZUXKFXWPMS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13ClO2S
Molecular weight244.74 g/mol
IUPAC name2-(2,3-dihydro-1H-inden-2-yl)ethanesulfonyl chloride
InChIKeyQZUYZUXKFXWPMS-UHFFFAOYSA-N
SMILESC1C(CC2=CC=CC=C21)CCS(=O)(=O)Cl

Computed by PubChem (NCBI)