CAS 2138288-21-6 is the registry number for 6-Chloro-4,4-dimethyl-3,4-dihydro-2H-1λâ¶-benzothiopyran-1,1-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-4,4-dimethyl-2,3-dihydrothiochromene 1,1-dioxide (CAS 2138288-21-6) is a chemical compound with the molecular formula C11H13ClO2S and a molecular weight of 244.74 g/mol. IUPAC name: 6-chloro-4,4-dimethyl-2,3-dihydrothiochromene 1,1-dioxide. InChIKey: AAYXIJCGCXHODG-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO2S |
|---|---|
| Molecular weight | 244.74 g/mol |
| IUPAC name | 6-chloro-4,4-dimethyl-2,3-dihydrothiochromene 1,1-dioxide |
| InChIKey | AAYXIJCGCXHODG-UHFFFAOYSA-N |
| SMILES | CC1(CCS(=O)(=O)C2=C1C=C(C=C2)Cl)C |
Computed by PubChem (NCBI)